1-(4-ethoxyphenyl)-N-{4-[(naphthalen-1-yl)methyl]piperazin-1-yl}methanimine
Chemical Structure Depiction of
1-(4-ethoxyphenyl)-N-{4-[(naphthalen-1-yl)methyl]piperazin-1-yl}methanimine
1-(4-ethoxyphenyl)-N-{4-[(naphthalen-1-yl)methyl]piperazin-1-yl}methanimine
Compound characteristics
| Compound ID: | 3253-4925 |
| Compound Name: | 1-(4-ethoxyphenyl)-N-{4-[(naphthalen-1-yl)methyl]piperazin-1-yl}methanimine |
| Molecular Weight: | 373.5 |
| Molecular Formula: | C24 H27 N3 O |
| Smiles: | CCOc1ccc(/C=N/N2CCN(CC2)Cc2cccc3ccccc23)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6922 |
| logD: | 4.648 |
| logSw: | -5.0315 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.6982 |
| InChI Key: | DNEDJZAWCFNVLY-UHFFFAOYSA-N |