2-amino-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Chemical Structure Depiction of
2-amino-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
2-amino-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Compound characteristics
| Compound ID: | Y507-1798 |
| Compound Name: | 2-amino-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| Molecular Weight: | 224.32 |
| Molecular Formula: | C11 H16 N2 O S |
| Smiles: | CCC1CCc2c(C(N)=O)c(N)sc2C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.4428 |
| logD: | 1.4428 |
| logSw: | -1.676 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 55.494 |
| InChI Key: | DDTYZCRSUWTPDY-ZCFIWIBFSA-N |