N-{[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}-N-methylpropan-2-amine
Chemical Structure Depiction of
N-{[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}-N-methylpropan-2-amine
N-{[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}-N-methylpropan-2-amine
Building block characteristics
| Compound ID: | BB01-0224 |
| Compound Name: | N-{[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}-N-methylpropan-2-amine |
| Molecular Weight: | 319.25 |
| Molecular Formula: | C18 H30 B N O3 |
| CAS Number: | 934586-45-5 |
| MFCD Number: | MFCD12027134 |
| Smiles: | [B]1(c2cc(CN(C)C(C)C)ccc2OC)OC(C)(C)C(C)(C)O1 |