ethyl 5-(hydroxymethylidene)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylate
Chemical Structure Depiction of
ethyl 5-(hydroxymethylidene)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylate
ethyl 5-(hydroxymethylidene)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylate
Building block characteristics
| Compound ID: | BB01-0336 |
| Compound Name: | ethyl 5-(hydroxymethylidene)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylate |
| Molecular Weight: | 250.25 |
| Molecular Formula: | C13 H14 O5 |
| MFCD Number: | MFCD14280389 |
| Smiles: | CCOC(c1c(C)c2C(C(\CCc2o1)=C/O)=O)=O |