3-[(4-chlorophenyl)sulfanyl]-6-methyl-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
3-[(4-chlorophenyl)sulfanyl]-6-methyl-1H-indole-2-carboxylic acid
3-[(4-chlorophenyl)sulfanyl]-6-methyl-1H-indole-2-carboxylic acid
Building block characteristics
| Compound ID: | BB01-0798 |
| Compound Name: | 3-[(4-chlorophenyl)sulfanyl]-6-methyl-1H-indole-2-carboxylic acid |
| Molecular Weight: | 317.79 |
| Molecular Formula: | C16 H12 Cl N O2 S |
| MFCD Number: | MFCD14280783 |
| Smiles: | Cc1ccc2c(c(C(O)=O)[nH]c2c1)Sc1ccc(cc1)[Cl] |