(3,4-dimethoxyphenyl)boronic acid
Chemical Structure Depiction of
(3,4-dimethoxyphenyl)boronic acid
(3,4-dimethoxyphenyl)boronic acid
Building block characteristics
| Compound ID: | BB01-0931 |
| Compound Name: | (3,4-dimethoxyphenyl)boronic acid |
| Molecular Weight: | 181.98 |
| Molecular Formula: | C8 H11 B O4 |
| CAS Number: | 122775-35-3 |
| MFCD Number: | MFCD01074574 |
| Smiles: | [B](c1ccc(c(c1)OC)OC)(O)O |