[3-(trifluoromethyl)phenyl]boronic acid
Chemical Structure Depiction of
[3-(trifluoromethyl)phenyl]boronic acid
[3-(trifluoromethyl)phenyl]boronic acid
Building block characteristics
| Compound ID: | BB01-0938 |
| Compound Name: | [3-(trifluoromethyl)phenyl]boronic acid |
| Molecular Weight: | 189.93 |
| Molecular Formula: | C7 H6 B F3 O2 |
| CAS Number: | 1423-26-3 |
| MFCD Number: | MFCD00151854 |
| Smiles: | [B](c1cccc(c1)C(F)(F)F)(O)O |