1-(3-fluorophenyl)-3-(4-methoxyphenyl)propan-2-amine
Chemical Structure Depiction of
1-(3-fluorophenyl)-3-(4-methoxyphenyl)propan-2-amine
1-(3-fluorophenyl)-3-(4-methoxyphenyl)propan-2-amine
Building block characteristics
| Compound ID: | BB01-2490 |
| Compound Name: | 1-(3-fluorophenyl)-3-(4-methoxyphenyl)propan-2-amine |
| Molecular Weight: | 259.32 |
| Molecular Formula: | C16 H18 F N O |
| MFCD Number: | MFCD14281861 |
| Smiles: | COc1ccc(CC(Cc2cccc(c2)F)N)cc1 |