methyl 4-(3-chloro-4-fluoroanilino)-4-oxobut-2-enoate
Chemical Structure Depiction of
methyl 4-(3-chloro-4-fluoroanilino)-4-oxobut-2-enoate
methyl 4-(3-chloro-4-fluoroanilino)-4-oxobut-2-enoate
Building block characteristics
| Compound ID: | BB01-2890 |
| Compound Name: | methyl 4-(3-chloro-4-fluoroanilino)-4-oxobut-2-enoate |
| Molecular Weight: | 257.65 |
| Molecular Formula: | C11 H9 Cl F N O3 |
| MFCD Number: | MFCD04153472 |
| Smiles: | COC(/C=C/C(Nc1ccc(c(c1)[Cl])F)=O)=O |