3-amino-3-{3-methoxy-4-[(propan-2-yl)oxy]phenyl}propanoic acid
Chemical Structure Depiction of
3-amino-3-{3-methoxy-4-[(propan-2-yl)oxy]phenyl}propanoic acid
3-amino-3-{3-methoxy-4-[(propan-2-yl)oxy]phenyl}propanoic acid
Building block characteristics
| Compound ID: | BB01-4103 |
| Compound Name: | 3-amino-3-{3-methoxy-4-[(propan-2-yl)oxy]phenyl}propanoic acid |
| Molecular Weight: | 253.3 |
| Molecular Formula: | C13 H19 N O4 |
| CAS Number: | 554402-59-4 |
| MFCD Number: | MFCD02656475 |
| Smiles: | CC(C)Oc1ccc(cc1OC)C(CC(O)=O)N |