1-benzyl-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
1-benzyl-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid
1-benzyl-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid
Building block characteristics
| Compound ID: | BB01-4280 |
| Compound Name: | 1-benzyl-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 291.35 |
| Molecular Formula: | C19 H17 N O2 |
| CAS Number: | 879329-79-0 |
| MFCD Number: | MFCD06812871 |
| Smiles: | Cc1c(cc(c2ccccc2)n1Cc1ccccc1)C(O)=O |