1-(2-methoxyethyl)-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
1-(2-methoxyethyl)-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid
1-(2-methoxyethyl)-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid
Building block characteristics
| Compound ID: | BB01-4308 |
| Compound Name: | 1-(2-methoxyethyl)-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 259.3 |
| Molecular Formula: | C15 H17 N O3 |
| CAS Number: | 724744-79-0 |
| MFCD Number: | MFCD04154122 |
| Smiles: | Cc1c(cc(c2ccccc2)n1CCOC)C(O)=O |