2-bromo-N-(3,4-dimethoxyphenyl)butanamide
Chemical Structure Depiction of
2-bromo-N-(3,4-dimethoxyphenyl)butanamide
2-bromo-N-(3,4-dimethoxyphenyl)butanamide
Building block characteristics
| Compound ID: | BB01-5509 |
| Compound Name: | 2-bromo-N-(3,4-dimethoxyphenyl)butanamide |
| Molecular Weight: | 302.17 |
| Molecular Formula: | C12 H16 Br N O3 |
| CAS Number: | 1119450-40-6 |
| MFCD Number: | MFCD12027347 |
| Smiles: | CCC(C(Nc1ccc(c(c1)OC)OC)=O)[Br] |