2-bromo-N-[2-(4-chlorophenyl)ethyl]butanamide
Chemical Structure Depiction of
2-bromo-N-[2-(4-chlorophenyl)ethyl]butanamide
2-bromo-N-[2-(4-chlorophenyl)ethyl]butanamide
Building block characteristics
| Compound ID: | BB01-5538 |
| Compound Name: | 2-bromo-N-[2-(4-chlorophenyl)ethyl]butanamide |
| Molecular Weight: | 304.61 |
| Molecular Formula: | C12 H15 Br Cl N O |
| CAS Number: | 1119452-43-5 |
| MFCD Number: | MFCD12027361 |
| Smiles: | CCC(C(NCCc1ccc(cc1)[Cl])=O)[Br] |