1,3-bis(4-methoxyphenyl)propane-1,3-dione
Chemical Structure Depiction of
1,3-bis(4-methoxyphenyl)propane-1,3-dione
1,3-bis(4-methoxyphenyl)propane-1,3-dione
Building block characteristics
| Compound ID: | BB01-8028 |
| Compound Name: | 1,3-bis(4-methoxyphenyl)propane-1,3-dione |
| Molecular Weight: | 284.31 |
| Molecular Formula: | C17 H16 O4 |
| CAS Number: | 18362-51-1 |
| MFCD Number: | MFCD00025817 |
| Smiles: | COc1ccc(cc1)C(CC(c1ccc(cc1)OC)=O)=O |