2-(4-fluoro-3-nitrophenyl)hexahydro-1H-4,7-methanoisoindole-1,3(2H)-dione
Chemical Structure Depiction of
2-(4-fluoro-3-nitrophenyl)hexahydro-1H-4,7-methanoisoindole-1,3(2H)-dione
2-(4-fluoro-3-nitrophenyl)hexahydro-1H-4,7-methanoisoindole-1,3(2H)-dione
Building block characteristics
| Compound ID: | BB01-8033 |
| Compound Name: | 2-(4-fluoro-3-nitrophenyl)hexahydro-1H-4,7-methanoisoindole-1,3(2H)-dione |
| Molecular Weight: | 304.28 |
| Molecular Formula: | C15 H13 F N2 O4 |
| MFCD Number: | MFCD02089356 |
| Smiles: | C1CC2CC1C1C2C(N(C1=O)c1ccc(c(c1)[N+]([O-])=O)F)=O |