N-cyclohexyl-N'-(4-fluoro-3-nitrophenyl)urea
Chemical Structure Depiction of
N-cyclohexyl-N'-(4-fluoro-3-nitrophenyl)urea
N-cyclohexyl-N'-(4-fluoro-3-nitrophenyl)urea
Building block characteristics
| Compound ID: | BB01-8080 |
| Compound Name: | N-cyclohexyl-N'-(4-fluoro-3-nitrophenyl)urea |
| Molecular Weight: | 281.28 |
| Molecular Formula: | C13 H16 F N3 O3 |
| MFCD Number: | MFCD03030224 |
| Smiles: | C1CCC(CC1)NC(Nc1ccc(c(c1)[N+]([O-])=O)F)=O |