methyl 5-[(4-bromo-2-nitrophenoxy)methyl]furan-2-carboxylate
Chemical Structure Depiction of
methyl 5-[(4-bromo-2-nitrophenoxy)methyl]furan-2-carboxylate
methyl 5-[(4-bromo-2-nitrophenoxy)methyl]furan-2-carboxylate
Building block characteristics
| Compound ID: | BB05-1632 |
| Compound Name: | methyl 5-[(4-bromo-2-nitrophenoxy)methyl]furan-2-carboxylate |
| Molecular Weight: | 356.13 |
| Molecular Formula: | C13 H10 Br N O6 |
| CAS Number: | 832738-22-4 |
| MFCD Number: | MFCD04967359 |
| Smiles: | COC(c1ccc(COc2ccc(cc2[N+]([O-])=O)[Br])o1)=O |