4-amino-N-[(furan-2-yl)methyl]-1-methyl-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
4-amino-N-[(furan-2-yl)methyl]-1-methyl-1H-pyrazole-5-carboxamide
4-amino-N-[(furan-2-yl)methyl]-1-methyl-1H-pyrazole-5-carboxamide
Building block characteristics
| Compound ID: | BB05-1845 |
| Compound Name: | 4-amino-N-[(furan-2-yl)methyl]-1-methyl-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 220.23 |
| Molecular Formula: | C10 H12 N4 O2 |
| CAS Number: | 1001500-15-7 |
| MFCD Number: | MFCD04969189 |
| Smiles: | Cn1c(C(NCc2ccco2)=O)c(cn1)N |