1-[(pentafluorophenyl)methyl]-1H-pyrazol-4-amine
Chemical Structure Depiction of
1-[(pentafluorophenyl)methyl]-1H-pyrazol-4-amine
1-[(pentafluorophenyl)methyl]-1H-pyrazol-4-amine
Building block characteristics
| Compound ID: | BB05-2588 |
| Compound Name: | 1-[(pentafluorophenyl)methyl]-1H-pyrazol-4-amine |
| Molecular Weight: | 263.17 |
| Molecular Formula: | C10 H6 F5 N3 |
| CAS Number: | 956440-84-9 |
| MFCD Number: | MFCD06740536 |
| Smiles: | C(c1c(c(c(c(c1F)F)F)F)F)n1cc(cn1)N |