methyl 5-({[(furan-2-yl)methyl]amino}methyl)furan-2-carboxylate hydrochloride
Chemical Structure Depiction of
methyl 5-({[(furan-2-yl)methyl]amino}methyl)furan-2-carboxylate hydrochloride
methyl 5-({[(furan-2-yl)methyl]amino}methyl)furan-2-carboxylate hydrochloride
Building block characteristics
| Compound ID: | BB05-3040 |
| Compound Name: | methyl 5-({[(furan-2-yl)methyl]amino}methyl)furan-2-carboxylate hydrochloride |
| Molecular Weight: | 235.24 |
| Molecular Formula: | C12 H13 N O4 |
| CAS Number: | 1177296-71-7 |
| MFCD Number: | MFCD07357547 |
| Salt: | HCl |
| Smiles: | COC(c1ccc(CNCc2ccco2)o1)=O |