1-[(4-chlorophenyl)methyl]-2-methyl-1H-indole-3-carbaldehyde
Chemical Structure Depiction of
1-[(4-chlorophenyl)methyl]-2-methyl-1H-indole-3-carbaldehyde
1-[(4-chlorophenyl)methyl]-2-methyl-1H-indole-3-carbaldehyde
Building block characteristics
| Compound ID: | BB05-3553 |
| Compound Name: | 1-[(4-chlorophenyl)methyl]-2-methyl-1H-indole-3-carbaldehyde |
| Molecular Weight: | 283.76 |
| Molecular Formula: | C17 H14 Cl N O |
| CAS Number: | 92407-86-8 |
| MFCD Number: | MFCD02215670 |
| Smiles: | Cc1c(C=O)c2ccccc2n1Cc1ccc(cc1)[Cl] |