methyl 3-amino-4-(4-fluorophenyl)thiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-amino-4-(4-fluorophenyl)thiophene-2-carboxylate
methyl 3-amino-4-(4-fluorophenyl)thiophene-2-carboxylate
Building block characteristics
| Compound ID: | BB10-0518 |
| Compound Name: | methyl 3-amino-4-(4-fluorophenyl)thiophene-2-carboxylate |
| Molecular Weight: | 251.28 |
| Molecular Formula: | C12 H10 F N O2 S |
| CAS Number: | 156274-32-7 |
| MFCD Number: | MFCD04116503 |
| Smiles: | COC(c1c(c(cs1)c1ccc(cc1)F)N)=O |