4-(chloromethyl)-1-(2-fluorophenyl)-1H-1,2,3-triazole
Chemical Structure Depiction of
4-(chloromethyl)-1-(2-fluorophenyl)-1H-1,2,3-triazole
4-(chloromethyl)-1-(2-fluorophenyl)-1H-1,2,3-triazole
Building block characteristics
| Compound ID: | BB10-1025 |
| Compound Name: | 4-(chloromethyl)-1-(2-fluorophenyl)-1H-1,2,3-triazole |
| Molecular Weight: | 211.62 |
| Molecular Formula: | C9 H7 Cl F N3 |
| MFCD Number: | MFCD16748023 |
| Smiles: | C(c1cn(c2ccccc2F)nn1)[Cl] |