5-(propan-2-yl)-1-{[3-(trifluoromethyl)phenyl]methyl}-1H-1,2,3-triazole-4-carboxylic acid
Chemical Structure Depiction of
5-(propan-2-yl)-1-{[3-(trifluoromethyl)phenyl]methyl}-1H-1,2,3-triazole-4-carboxylic acid
5-(propan-2-yl)-1-{[3-(trifluoromethyl)phenyl]methyl}-1H-1,2,3-triazole-4-carboxylic acid
Building block characteristics
| Compound ID: | BB10-3839 |
| Compound Name: | 5-(propan-2-yl)-1-{[3-(trifluoromethyl)phenyl]methyl}-1H-1,2,3-triazole-4-carboxylic acid |
| Molecular Weight: | 313.28 |
| Molecular Formula: | C14 H14 F3 N3 O2 |
| MFCD Number: | MFCD25950146 |
| Smiles: | CC(C)c1c(C(O)=O)nnn1Cc1cccc(c1)C(F)(F)F |