[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-1H-1,2,3-triazol-4-yl]methanol
Chemical Structure Depiction of
[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-1H-1,2,3-triazol-4-yl]methanol
[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-1H-1,2,3-triazol-4-yl]methanol
Building block characteristics
| Compound ID: | BB10-4405 |
| Compound Name: | [5-(4-chlorophenyl)-1-(4-methoxyphenyl)-1H-1,2,3-triazol-4-yl]methanol |
| Molecular Weight: | 315.76 |
| Molecular Formula: | C16 H14 Cl N3 O2 |
| MFCD Number: | MFCD25950556 |
| Smiles: | COc1ccc(cc1)n1c(c2ccc(cc2)[Cl])c(CO)nn1 |