4-(chloromethyl)-1-(3-fluorophenyl)-5-(3-methoxyphenyl)-1H-1,2,3-triazole
Chemical Structure Depiction of
4-(chloromethyl)-1-(3-fluorophenyl)-5-(3-methoxyphenyl)-1H-1,2,3-triazole
4-(chloromethyl)-1-(3-fluorophenyl)-5-(3-methoxyphenyl)-1H-1,2,3-triazole
Building block characteristics
| Compound ID: | BB10-4681 |
| Compound Name: | 4-(chloromethyl)-1-(3-fluorophenyl)-5-(3-methoxyphenyl)-1H-1,2,3-triazole |
| Molecular Weight: | 317.75 |
| Molecular Formula: | C16 H13 Cl F N3 O |
| MFCD Number: | MFCD25950796 |
| Smiles: | COc1cccc(c1)c1c(C[Cl])nnn1c1cccc(c1)F |