tert-butyl {[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl}carbamate
Chemical Structure Depiction of
tert-butyl {[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl}carbamate
tert-butyl {[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl}carbamate
Building block characteristics
| Compound ID: | BB10-5985 |
| Compound Name: | tert-butyl {[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl}carbamate |
| Molecular Weight: | 281.33 |
| Molecular Formula: | C12 H15 N3 O3 S |
| MFCD Number: | MFCD25951578 |
| Smiles: | CC(C)(C)OC(NCc1nc(c2cccs2)no1)=O |