tert-butyl {(1RS)-1-[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]ethyl}carbamate
Chemical Structure Depiction of
tert-butyl {(1RS)-1-[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]ethyl}carbamate
tert-butyl {(1RS)-1-[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]ethyl}carbamate
Building block characteristics
| Compound ID: | BB10-5989 |
| Compound Name: | tert-butyl {(1RS)-1-[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]ethyl}carbamate |
| Molecular Weight: | 295.36 |
| Molecular Formula: | C13 H17 N3 O3 S |
| MFCD Number: | MFCD25951579 |
| Smiles: | C[C@@H](c1nc(c2cccs2)no1)NC(=O)OC(C)(C)C |