[3-(3,4-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]acetic acid
Chemical Structure Depiction of
[3-(3,4-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]acetic acid
[3-(3,4-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]acetic acid
Building block characteristics
| Compound ID: | BB10-6620 |
| Compound Name: | [3-(3,4-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]acetic acid |
| Molecular Weight: | 258.27 |
| Molecular Formula: | C14 H14 N2 O3 |
| MFCD Number: | MFCD09881854 |
| Smiles: | Cc1ccc(cc1C)C1C=CC(N(CC(O)=O)N=1)=O |