tert-butyl {1-[2-(3,4-dimethylphenyl)-2-oxoethyl]piperidin-4-yl}carbamate
Chemical Structure Depiction of
tert-butyl {1-[2-(3,4-dimethylphenyl)-2-oxoethyl]piperidin-4-yl}carbamate
tert-butyl {1-[2-(3,4-dimethylphenyl)-2-oxoethyl]piperidin-4-yl}carbamate
Building block characteristics
| Compound ID: | BB10-7536 |
| Compound Name: | tert-butyl {1-[2-(3,4-dimethylphenyl)-2-oxoethyl]piperidin-4-yl}carbamate |
| Molecular Weight: | 346.47 |
| Molecular Formula: | C20 H30 N2 O3 |
| MFCD Number: | MFCD25952280 |
| Smiles: | Cc1ccc(cc1C)C(CN1CCC(CC1)NC(=O)OC(C)(C)C)=O |