methyl 1-[(3,4-dimethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate
Chemical Structure Depiction of
methyl 1-[(3,4-dimethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate
methyl 1-[(3,4-dimethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate
Building block characteristics
| Compound ID: | BB10-8991 |
| Compound Name: | methyl 1-[(3,4-dimethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate |
| Molecular Weight: | 307.34 |
| Molecular Formula: | C16 H21 N O5 |
| MFCD Number: | MFCD16464191 |
| Smiles: | COC(C1CN(CCC1=O)Cc1ccc(c(c1)OC)OC)=O |