2-(4-chloro-2-methylanilino)butanehydrazide
Chemical Structure Depiction of
2-(4-chloro-2-methylanilino)butanehydrazide
2-(4-chloro-2-methylanilino)butanehydrazide
Building block characteristics
| Compound ID: | BB12-2589 |
| Compound Name: | 2-(4-chloro-2-methylanilino)butanehydrazide |
| Molecular Weight: | 241.72 |
| Molecular Formula: | C11 H16 Cl N3 O |
| CAS Number: | 1218231-06-1 |
| MFCD Number: | MFCD11696416 |
| Smiles: | CCC(C(NN)=O)Nc1ccc(cc1C)[Cl] |