5-bromo-1-butyl-1H-indole-2,3-dione
Chemical Structure Depiction of
5-bromo-1-butyl-1H-indole-2,3-dione
5-bromo-1-butyl-1H-indole-2,3-dione
Building block characteristics
| Compound ID: | BB12-3781 |
| Compound Name: | 5-bromo-1-butyl-1H-indole-2,3-dione |
| Molecular Weight: | 282.13 |
| Molecular Formula: | C12 H12 Br N O2 |
| CAS Number: | 332929-55-2 |
| MFCD Number: | MFCD02108042 |
| Smiles: | CCCCN1C(C(c2cc(ccc12)[Br])=O)=O |