5-(4-fluorophenyl)cyclohexane-1,3-dione
Chemical Structure Depiction of
5-(4-fluorophenyl)cyclohexane-1,3-dione
5-(4-fluorophenyl)cyclohexane-1,3-dione
Building block characteristics
| Compound ID: | BB12-3871 |
| Compound Name: | 5-(4-fluorophenyl)cyclohexane-1,3-dione |
| Molecular Weight: | 206.21 |
| Molecular Formula: | C12 H11 F O2 |
| CAS Number: | 55579-72-1 |
| MFCD Number: | MFCD00174037 |
| Smiles: | C1C(CC(CC1=O)=O)c1ccc(cc1)F |