[5-(4-bromo-3,5-dichlorophenyl)furan-2-yl]methanol
Chemical Structure Depiction of
[5-(4-bromo-3,5-dichlorophenyl)furan-2-yl]methanol
[5-(4-bromo-3,5-dichlorophenyl)furan-2-yl]methanol
Building block characteristics
| Compound ID: | BB12-5254 |
| Compound Name: | [5-(4-bromo-3,5-dichlorophenyl)furan-2-yl]methanol |
| Molecular Weight: | 321.98 |
| Molecular Formula: | C11 H7 Br Cl2 O2 |
| MFCD Number: | MFCD18914589 |
| Smiles: | C(c1ccc(c2cc(c(c(c2)[Cl])[Br])[Cl])o1)O |