5-(4-bromo-3,5-dichlorophenyl)furan-2-carbaldehyde
Chemical Structure Depiction of
5-(4-bromo-3,5-dichlorophenyl)furan-2-carbaldehyde
5-(4-bromo-3,5-dichlorophenyl)furan-2-carbaldehyde
Building block characteristics
| Compound ID: | BB12-5255 |
| Compound Name: | 5-(4-bromo-3,5-dichlorophenyl)furan-2-carbaldehyde |
| Molecular Weight: | 319.97 |
| Molecular Formula: | C11 H5 Br Cl2 O2 |
| MFCD Number: | MFCD18914590 |
| Smiles: | C(c1ccc(c2cc(c(c(c2)[Cl])[Br])[Cl])o1)=O |