[5-(3,4,5-tribromophenyl)furan-2-yl]methanol
Chemical Structure Depiction of
[5-(3,4,5-tribromophenyl)furan-2-yl]methanol
[5-(3,4,5-tribromophenyl)furan-2-yl]methanol
Building block characteristics
| Compound ID: | BB12-5257 |
| Compound Name: | [5-(3,4,5-tribromophenyl)furan-2-yl]methanol |
| Molecular Weight: | 410.88 |
| Molecular Formula: | C11 H7 Br3 O2 |
| MFCD Number: | MFCD18914592 |
| Smiles: | C(c1ccc(c2cc(c(c(c2)[Br])[Br])[Br])o1)O |