5,7-dibromo-2-(naphthalen-1-yl)-1,3-benzoxazol-6-amine
Chemical Structure Depiction of
5,7-dibromo-2-(naphthalen-1-yl)-1,3-benzoxazol-6-amine
5,7-dibromo-2-(naphthalen-1-yl)-1,3-benzoxazol-6-amine
Building block characteristics
| Compound ID: | BB12-5531 |
| Compound Name: | 5,7-dibromo-2-(naphthalen-1-yl)-1,3-benzoxazol-6-amine |
| Molecular Weight: | 418.09 |
| Molecular Formula: | C17 H10 Br2 N2 O |
| MFCD Number: | MFCD19685038 |
| Smiles: | c1ccc2c(cccc2c1)c1nc2cc(c(c(c2o1)[Br])N)[Br] |