2-[(4-chlorophenyl)methyl]-1,3-benzoxazol-6-amine
Chemical Structure Depiction of
2-[(4-chlorophenyl)methyl]-1,3-benzoxazol-6-amine
2-[(4-chlorophenyl)methyl]-1,3-benzoxazol-6-amine
Building block characteristics
| Compound ID: | BB12-5632 |
| Compound Name: | 2-[(4-chlorophenyl)methyl]-1,3-benzoxazol-6-amine |
| Molecular Weight: | 258.7 |
| Molecular Formula: | C14 H11 Cl N2 O |
| CAS Number: | 1038717-45-1 |
| MFCD Number: | MFCD11188328 |
| Smiles: | C(c1ccc(cc1)[Cl])c1nc2ccc(cc2o1)N |