2-(4-bromo-2-chlorophenyl)-5-methylfuran
Chemical Structure Depiction of
2-(4-bromo-2-chlorophenyl)-5-methylfuran
2-(4-bromo-2-chlorophenyl)-5-methylfuran
Building block characteristics
| Compound ID: | BB12-5860 |
| Compound Name: | 2-(4-bromo-2-chlorophenyl)-5-methylfuran |
| Molecular Weight: | 271.54 |
| Molecular Formula: | C11 H8 Br Cl O |
| CAS Number: | 1279215-15-4 |
| MFCD Number: | MFCD18785087 |
| Smiles: | Cc1ccc(c2ccc(cc2[Cl])[Br])o1 |