2-(2-bromo-4-chlorophenyl)-5-methylfuran
Chemical Structure Depiction of
2-(2-bromo-4-chlorophenyl)-5-methylfuran
2-(2-bromo-4-chlorophenyl)-5-methylfuran
Building block characteristics
| Compound ID: | BB12-5861 |
| Compound Name: | 2-(2-bromo-4-chlorophenyl)-5-methylfuran |
| Molecular Weight: | 271.54 |
| Molecular Formula: | C11 H8 Br Cl O |
| CAS Number: | 1279216-59-9 |
| MFCD Number: | MFCD18785088 |
| Smiles: | Cc1ccc(c2ccc(cc2[Br])[Cl])o1 |