2-(3,4-dichlorophenyl)-5-methylfuran
Chemical Structure Depiction of
2-(3,4-dichlorophenyl)-5-methylfuran
2-(3,4-dichlorophenyl)-5-methylfuran
Building block characteristics
| Compound ID: | BB12-5863 |
| Compound Name: | 2-(3,4-dichlorophenyl)-5-methylfuran |
| Molecular Weight: | 227.09 |
| Molecular Formula: | C11 H8 Cl2 O |
| CAS Number: | 1279218-92-6 |
| MFCD Number: | MFCD18785090 |
| Smiles: | Cc1ccc(c2ccc(c(c2)[Cl])[Cl])o1 |