4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline
Chemical Structure Depiction of
4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline
4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline
Building block characteristics
| Compound ID: | BB12-5870 |
| Compound Name: | 4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline |
| Molecular Weight: | 252.31 |
| Molecular Formula: | C16 H16 N2 O |
| MFCD Number: | MFCD18785094 |
| Smiles: | Cc1cc(C)c2c(c1)nc(Cc1ccc(cc1)N)o2 |