2-(3,5-dimethylphenyl)-5-methyl-2H-1,2,3-triazole-4-carbonyl chloride
Chemical Structure Depiction of
2-(3,5-dimethylphenyl)-5-methyl-2H-1,2,3-triazole-4-carbonyl chloride
2-(3,5-dimethylphenyl)-5-methyl-2H-1,2,3-triazole-4-carbonyl chloride
Building block characteristics
| Compound ID: | BB12-5898 |
| Compound Name: | 2-(3,5-dimethylphenyl)-5-methyl-2H-1,2,3-triazole-4-carbonyl chloride |
| Molecular Weight: | 249.7 |
| Molecular Formula: | C12 H12 Cl N3 O |
| MFCD Number: | MFCD18785117 |
| Smiles: | Cc1cc(C)cc(c1)n1nc(C)c(C(=O)[Cl])n1 |