2-phenyl-1,3-benzoxazole-6-carboxylic acid
Chemical Structure Depiction of
2-phenyl-1,3-benzoxazole-6-carboxylic acid
2-phenyl-1,3-benzoxazole-6-carboxylic acid
Building block characteristics
| Compound ID: | BB12-5927 |
| Compound Name: | 2-phenyl-1,3-benzoxazole-6-carboxylic acid |
| Molecular Weight: | 239.23 |
| Molecular Formula: | C14 H9 N O3 |
| CAS Number: | 594839-90-4 |
| MFCD Number: | MFCD11890771 |
| Smiles: | c1ccc(cc1)c1nc2ccc(cc2o1)C(O)=O |