methyl 2,4-dichloro-5-(4H-1,2,4-triazol-4-yl)benzoate
Chemical Structure Depiction of
methyl 2,4-dichloro-5-(4H-1,2,4-triazol-4-yl)benzoate
methyl 2,4-dichloro-5-(4H-1,2,4-triazol-4-yl)benzoate
Building block characteristics
| Compound ID: | BB12-6346 |
| Compound Name: | methyl 2,4-dichloro-5-(4H-1,2,4-triazol-4-yl)benzoate |
| Molecular Weight: | 272.09 |
| Molecular Formula: | C10 H7 Cl2 N3 O2 |
| MFCD Number: | MFCD19288191 |
| Smiles: | COC(c1cc(c(cc1[Cl])[Cl])n1cnnc1)=O |