3-ethyl-5-[(4-methoxy-2-nitrophenyl)sulfanyl]-4H-1,2,4-triazole
Chemical Structure Depiction of
3-ethyl-5-[(4-methoxy-2-nitrophenyl)sulfanyl]-4H-1,2,4-triazole
3-ethyl-5-[(4-methoxy-2-nitrophenyl)sulfanyl]-4H-1,2,4-triazole
Building block characteristics
| Compound ID: | BB12-7058 |
| Compound Name: | 3-ethyl-5-[(4-methoxy-2-nitrophenyl)sulfanyl]-4H-1,2,4-triazole |
| Molecular Weight: | 280.3 |
| Molecular Formula: | C11 H12 N4 O3 S |
| MFCD Number: | MFCD19684300 |
| Smiles: | CCc1nnc([nH]1)Sc1ccc(cc1[N+]([O-])=O)OC |