3-[(2-chloro-6-nitrophenyl)sulfanyl]-4H-1,2,4-triazol-4-amine
Chemical Structure Depiction of
3-[(2-chloro-6-nitrophenyl)sulfanyl]-4H-1,2,4-triazol-4-amine
3-[(2-chloro-6-nitrophenyl)sulfanyl]-4H-1,2,4-triazol-4-amine
Building block characteristics
| Compound ID: | BB12-7104 |
| Compound Name: | 3-[(2-chloro-6-nitrophenyl)sulfanyl]-4H-1,2,4-triazol-4-amine |
| Molecular Weight: | 271.68 |
| Molecular Formula: | C8 H6 Cl N5 O2 S |
| MFCD Number: | MFCD19684341 |
| Smiles: | c1cc(c(c(c1)[Cl])Sc1nncn1N)[N+]([O-])=O |