2-bromo-N-[(2-chlorophenyl)methyl]acetamide
Chemical Structure Depiction of
2-bromo-N-[(2-chlorophenyl)methyl]acetamide
2-bromo-N-[(2-chlorophenyl)methyl]acetamide
Building block characteristics
| Compound ID: | BB17-0252 |
| Compound Name: | 2-bromo-N-[(2-chlorophenyl)methyl]acetamide |
| Molecular Weight: | 262.53 |
| Molecular Formula: | C9 H9 Br Cl N O |
| CAS Number: | 1119111-64-6 |
| MFCD Number: | MFCD12026617 |
| Smiles: | C(c1ccccc1[Cl])NC(C[Br])=O |